| Identification | |
| Name: | 4-Chlororesorcinol |
| Synonyms: | 1-Chloro-2,4-dihydroxybenzene; 4-Chloro Resorcinol |
| CAS: | 95-88-5 |
| EINECS: | 202-462-0 |
| Molecular Formula: | C6H5ClO2 |
| Molecular Weight: | 144.56 |
| InChI: | InChI=1/C6H5ClO2/c7-5-2-1-4(8)3-6(5)9/h1-3,8-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 121.6ºC |
| Density: | 1.471 g/cm3 |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, oxidizing agents. |
| Water Solubility: | soluble |
| Solubility: | Easily soluble |
| Appearance: | White |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. Chlorophenols are on the Community Right-To-Know List. |
| Packinggroup: | I; II; III |
| HS Code: | 29081000 |
| Flash Point: | 121.6ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
