| Identification | |
| Name: | 3-Chloro-2,5-dimethylpyrazine |
| Synonyms: | 2-Chloro-3,6-dimethylpyrazine;Pyrazine, 3-chloro-2,5-dimethyl-;2,5-Dimethyl-3-chloropyrazine;3-Chloro-2,5-dimethyl-1,4-diazine; |
| CAS: | 95-89-6 |
| EINECS: | 202-463-6 |
| Molecular Formula: | C6H7ClN2 |
| Molecular Weight: | 142.5862 |
| InChI: | InChI=1/C8H11ClN2/c1-3-6-5-10-7(4-2)8(9)11-6/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.184 g/cm3 |
| Refractive index: | 1.527 |
| Appearance: | Colorless to brown liquid |
| Specification: |
3-Chloro-2,5-dimethylpyrazine , its cas register number is 95-89-6. It also can be called 3-Chloro-2,5-dimethyl-1,4-diazine ; Pyrazine, 3-chloro-2,5-dimethyl- ; 2,5-Dimethyl-3-chloropyrazine . |
| Safety Data | |
 |
|
