| Identification | |
| Name: | Cytidine,2'-deoxy- |
| Synonyms: | Cytidine,deoxy- (6CI,7CI);1-(2-Deoxy-b-D-ribofuranosyl)cytosine;2(1H)-Pyrimidinone, 4-amino-1-(2-deoxy-b-D-erythro-pentofuranosyl)-;2'-Deoxycytidine;4-Amino-1-(2-deoxy-b-D-erythro-pentofuranosyl)-2(1H)-pyrimidinone;Cytosine deoxyribonucleoside;Cytosine deoxyriboside;Deoxycytidine;Deoxyribose cytidine; |
| CAS: | 951-77-9 |
| EINECS: | 213-454-1 |
| Molecular Formula: | C9H13N3O4 |
| Molecular Weight: | 227.22 |
| InChI: | InChI=1S/C9H13N3O4/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Melting Point: | 209 - 211 C |
| Density: | 1.73g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Appearance:fine
off-white crystalline powder Transport Information:HAZARD Hazard Symbols:UN NO. Safety:Experimental reproductive effects. Mutation data reported. When heated to decomposition it emits toxic fumes of NOx. |
| Appearance: | fine off-white crystalline powder |
| Storage Temperature: | Store at RT. |
| Usage: | A deoxyribonucleoside. |
| Safety Data | |
| Hazard Symbols | |
 |
|
