Identification |
Name: | Cytidine,2'-deoxy- |
Synonyms: | Cytidine,deoxy- (6CI,7CI);1-(2-Deoxy-b-D-ribofuranosyl)cytosine;2(1H)-Pyrimidinone, 4-amino-1-(2-deoxy-b-D-erythro-pentofuranosyl)-;2'-Deoxycytidine;4-Amino-1-(2-deoxy-b-D-erythro-pentofuranosyl)-2(1H)-pyrimidinone;Cytosine deoxyribonucleoside;Cytosine deoxyriboside;Deoxycytidine;Deoxyribose cytidine; |
CAS: | 951-77-9 |
EINECS: | 213-454-1 |
Molecular Formula: | C9H13N3O4 |
Molecular Weight: | 227.22 |
InChI: | InChI=1S/C9H13N3O4/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15) |
Molecular Structure: |
 |
Properties |
Transport: | HAZARD |
Melting Point: | 209 - 211 C |
Density: | 1.73g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Solubility: | Appearance:fine
off-white crystalline powder Transport Information:HAZARD
Hazard Symbols:UN
NO. Safety:Experimental reproductive effects. Mutation data reported. When heated to decomposition it emits toxic fumes of NOx.
|
Appearance: | fine
off-white crystalline powder |
Storage Temperature: | Store at RT. |
Usage: | A deoxyribonucleoside. |
Safety Data |
Hazard Symbols |
|
|
 |