| Identification | |
| Name: | Pyrimidine,4-(4-piperidinyl)- |
| Synonyms: | 4-(Piperidin-4-yl)pyrimidine; |
| CAS: | 954220-47-4 |
| Molecular Formula: | C9H13N3 |
| Molecular Weight: | 163.22 |
| InChI: | InChI=1/C9H13N3/c1-4-10-5-2-8(1)9-3-6-11-7-12-9/h3,6-8,10H,1-2,4-5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.065 g/cm3 |
| Refractive index: | 1.526 |
| Specification: |
The 4-(Piperidin-4-yl)pyrimidine with the cas number 954220-47-4 is also called Pyrimidine,4-(4-piperidinyl)-. Its molecular formula is C9H13N3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)# of Rule of 5 Violations: 0 ; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 3; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 1; (9)Polar Surface Area: 37.81 Å2; (10)Index of Refraction: 1.526; (11)Molar Refractivity: 47.03 cm3; (12)Molar Volume: 153.1 cm3; (13)Polarizability: 18.64×10-24cm3; (14)Surface Tension: 44.1 dyne/cm; (15)Enthalpy of Vaporization: 53.39 kJ/mol; (16)Vapour Pressure: 0.00164 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
