| Identification |
| Name: | D-aspartic acid - 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol (1:1) |
| Synonyms: | Pyridoxine aspartate;Aspartate de pyridoxine [French];L-Aspartic acid, compd. with 5-hydroxy-6-methyl-3,4-pyridinedimethanol (1:1);Aspartate de pyridoxine;AC1L36DI;95468-91-0;LS-22117;(2R)-2-aminobutanedioic acid; 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, L-aspartate (1:1) (salt);3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, L-aspartate (1:1) (salt) (9CI) |
| CAS: | 95468-91-0 |
| Molecular Formula: | C12H18N2O7 |
| Molecular Weight: | 302.2805 |
| InChI: | InChI=1/C8H11NO3.C4H7NO4/c1-5-8(12)7(4-11)6(3-10)2-9-5;5-2(4(8)9)1-3(6)7/h2,10-12H,3-4H2,1H3;2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.1/s1 |
| Molecular Structure: |
![(C12H18N2O7) Pyridoxine aspartate;Aspartate de pyridoxine [French];L-Aspartic acid, compd. with 5-hydroxy-6-methy...](https://img.guidechem.com/pic/image/95468-91-0.png) |
| Properties |
| Flash Point: | 251.3°C |
| Boiling Point: | 491.9°C at 760 mmHg |
| Flash Point: | 251.3°C |
| Safety Data |
| |
 |
