| Identification |
| Name: | Pregna-4,17(20)-diene-3,16-dione |
| Synonyms: | Guggulsterone;Guglip;Gugulipid;Z/E-Guggulsterone; |
| CAS: | 95975-55-6 |
| Molecular Formula: | C21H28O2 |
| Molecular Weight: | 267.15048 |
| InChI: | InChI=1S/C14H12Cl2O/c15-12-5-1-10(2-6-12)14(9-17)11-3-7-13(16)8-4-11/h1-8,14,17H,9H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.1 g/cm3 |
| Refractive index: | 1.557 |
| Water Solubility: | DMSO: 5 mg/mL |
| Solubility: | DMSO: 5 mg/mL |
| Appearance: | Light yellow powder |
| Biological Activity: | Broad spectrum steroid receptor ligand; binds with high affinity to mineralocorticoid receptors (K i = 39 nM) and lower affinity to progesterone, androgen and glucocorticoid receptors (K i values are 201, 240 and 224 nM respectively). Functions primarily as an antagonist of these receptors, with the exception of the progesterone receptor where it displays partial agonist effects. Also exerts hypolipidemic activity, likely via antagonism of the receptor for bile acids (farnesoid X receptor; FXR). |
| Storage Temperature: | 2-8°C |
| Color: | light yellow |
| Safety Data |
| |
 |
