| Identification | |
| Name: | 3-Methylpentane |
| Synonyms: | Methylpentane, 99% |
| CAS: | 96-14-0 |
| EINECS: | 202-481-4 |
| Molecular Formula: | C6H14 |
| Molecular Weight: | 86.17 |
| InChI: | InChI=1/C6H14/c1-4-6(3)5-2/h6H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1208 3 |
| Density: | 0.66 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.376(lit.) |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | clear, colorless liquid |
| Specification: |
3-Methylpentane (96-14-0) is colorless clear liquid with gasoline-like. It is also known as AI3-28852 ; Diethylmethylmethane ; HSDB 5300 ; NSC 66497 ; Pentane, 3-methyl- . It is incompatible with strong oxidizing agents. When heated to decomposition, it yields Carbon monoxide , Carbon dioxide . It is a structural isomer of hexane composed of a methyl group bonded to the third carbon atom in a pentane chain. 3-Methylpentane (96-14-0) can be used in organic synthesis and used as a solvent. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
F:Highlyflammable
|
 |
|
