| Identification | |
| Name: | 1-Butanamine, 2-methyl- |
| Synonyms: | Butylamine,2-methyl- (6CI,7CI,8CI);1-Amino-2-methylbutane;2-Ethylpropylamine;2-Methyl-1-butylamine;dl-2-Methylbutylamine;b-Methylbutylamine; |
| CAS: | 96-15-1 |
| EINECS: | 202-483-5 |
| Molecular Formula: | C5H13N |
| Molecular Weight: | 87.16 |
| InChI: | InChI=1/C5H13N/c1-3-5(2)4-6/h5H,3-4,6H2,1-2H3/p+1/t5-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2733 3 |
| Refractive index: | n20/D 1.4116(lit.) |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | Colourless to yellowish liquid; Fishy aroma |
| Specification: |
1-Butanamine, 2-methyl- , with CAS number of 96-15-1, can be called 2-Methyl-1-butylamine ; 1-amino-2-methylbutane ; 1-amino-3-methylbutane;rarechem al bw 0193 ; 1-amino-2-methylbutan ; 1-butanamine,2-methyl- ; 2-methyl-1-butanamin ; 2-methyl-1-butanamine . It is a clear colourless to slightly yellow liquid. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
F: Flammable
|
 |
|
