| Identification | |
| Name: | 1,2,3-Trichloropropane |
| Synonyms: | 1,2,3-Trichloropropane;Allyl trichloride; Glycerol trichlorohydrin; Glyceryl trichlorohydrin; NSC35403; Trichlorohydrin |
| CAS: | 96-18-4 |
| EINECS: | 202-486-1 |
| Molecular Formula: | C3H5 Cl3 |
| Molecular Weight: | 147.431 |
| InChI: | InChI=1S/C3H5Cl3/c4-1-3(6)2-5/h3H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.386 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4825-1.4845 |
| Solubility: | 2 g/L (25 ºC) |
| Appearance: | Colorless to straw colored liquid with an acrid, chloroform-like odor. |
| Report: |
NTP 10th Report on Carcinogens. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29031980 |
| Storage Temperature: | -20°C |
| Color: | Colorless liquid |
| Usage: | Paintermediate and varnish remover, solvent, degreasing agent. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
