| Identification | |
| Name: | 1,3-Dimethylurea |
| Synonyms: | Urea,1,3-dimethyl- (8CI);N,N'-Dimethylurea;NSC 14910;NSC 24823;Symmetric dimethylurea;sym-Dimethylurea; |
| CAS: | 96-31-1 |
| EINECS: | 202-498-7 |
| Molecular Formula: | C3H8N2O |
| Molecular Weight: | 88.11 |
| InChI: | InChI=1/C3H8N2O/c1-4-3(6)5-2/h1-2H3,(H2,4,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.142 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.413 |
| Appearance: | white flake |
| Specification: |
1,3-Dimethylurea , with CAS number of 96-31-1, can be called N,N'-Dimethylharnstoff ; N,N'-Dimethylurea ; Symmetric dimethylurea ; sym-Dimethylurea . It is a white crystal, 1,3-Dimethylurea (CAS NO.96-31-1) is an amide. Amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). |
| Report: |
1,3-Dimethylurea (CAS NO.96-31-1) is reported in EPA TSCA Inventory. |
| HS Code: | 29241900 |
| Storage Temperature: | Store at RT. |
| Color: | RHOMBIC BIPYRAMIDAL CRYSTALS FROM CHLOROFORM-ETHER COLORLESS PRISMS |
| Safety Data | |
 |
|
