| Identification |
| Name: | methylacrylate |
| Synonyms: | 2-Propenoic Acid Methyl Ester; Acrylic Acid Methyl Ester; curithane 103; Methoxycarbonylethylene; methyl 2-propenoate; methyl acrylate; Methyl acrylate? Methyl acrylate, stabilized with 200 ppm MEHQ; methyl ester acrylic acid; methyl propenoate; propenoic acid methyl ester; [sri773]methylacrylate,monomer; 2-Propenoicacidmethylesetr; Acrylate de methyle; acrylatedemethyle; acrylatedemethyle(french); Acrylsaeuremethylester; CH2=CHCOOCH3 |
| CAS: | 96-33-3 |
| EINECS: | 202-500-6 |
| Molecular Formula: | C4H6O2 |
| Molecular Weight: | 86.09 |
| InChI: | InChI=1/C4H6O2/c1-3-4(5)6-2/h3H,1H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1919 |
| Density: | 0.956 |
| Stability: | Stable. Incompatible with bases, acids, oxidizing agents, peroxides. May polymerize on exposure to light. Highly flammable. Commercial product may be inhibited by the presence of hydroquinone monomethyl ether. |
| Refractive index: | 1.401-1.404 |
| Solubility: | 60 g/L (20 oC) in waterSoluble in ether and alcohol |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Color: | Colorless volatile liquid |
| Safety Data |
| Hazard Symbols |
F:Flammable
|
| |
 |
