| Identification | |
| Name: | 2-(diisopropylamino)ethanol |
| Synonyms: | 2-Diisopropylaminoethanol; diisopropylethanolamine; N,N-diisopropyl ethanolamine; |
| CAS: | 96-80-0 |
| EINECS: | 202-536-2 |
| Molecular Formula: | C8H19NO |
| Molecular Weight: | 145.24 |
| InChI: | InChI=1/C8H19NO/c1-7(2)9(5-6-10)8(3)4/h7-8,10H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2825/2922 |
| Melting Point: | -39.3 |
| Flash Point: | 158? |
| Density: | 0.826 |
| Stability: | Stable. Incompatible with acids, strong oxidizing agents. |
| Refractive index: | 1.442 |
| Appearance: | colourless to slightly yellow liquid |
| Specification: |
2-Diisopropylaminoethanol (96-80-0) also can be called (Diisopropylamino)ethanol ; Ethanol, 2-[bis(1-methylethyl)amino]- ; Ethanol, 2- (diisopropylamino)- ; N,N-diisopropyl ethanolamine ; Diisopropylethanolamine . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 158? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
