| Identification | |
| Name: | 2,4-Dinitrodiphenylamine |
| Synonyms: | 2,4-dinitro-N-phenylaniline |
| CAS: | 961-68-2 |
| EINECS: | 213-508-4 |
| Molecular Formula: | C12H9N3O4 |
| Molecular Weight: | 259.22 |
| InChI: | InChI=1/C12H9N3O4/c16-14(17)10-6-7-11(12(8-10)15(18)19)13-9-4-2-1-3-5-9/h1-8,13H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61811 |
| Flash Point: | 204.1 ºC |
| Boiling Point: | 413.8 ºCat 760 mmHg |
| Density: | 1.446 g/cm3 |
| Stability: | Stable. Incompatible with strong bases, strong acids, strong oxidizing agents. |
| Refractive index: | 1.693 |
| Solubility: | Insoluble |
| Appearance: | Red-brown powder. |
| Specification: |
2,4-Dinitrodiphenylamine (961-68-2) is a light yellow needle crystal and it is mainly used as an intermediate in organic synthesis. It is soluble in acetone, chloroform, pyridine and hot ethanol, slightly soluble in water. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | O53 |
| Flash Point: | 204.1 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
