| Identification | |
| Name: | 1H-Indole-2-methanamine,N,a-dimethyl- |
| CAS: | 96286-08-7 |
| Molecular Formula: | C11H14 N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H14N2/c1-8(12-2)11-7-9-5-3-4-6-10(9)13-11/h3-8,12-13H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 141.3°C |
| Boiling Point: | 310.1°C at 760 mmHg |
| Density: | 1.083g/cm3 |
| Refractive index: | 1.617 |
| Flash Point: | 141.3°C |
| Usage: | A useful intermediate for the synthesis of pharmaceutical actives, intermediates and fine chemicals |
| Safety Data | |
 |
|
