Identification |
Name: | Tetramethyl 5-Formyl-5'-Methyl Bis-(2-Aminophenoxymethylene)-N,N,N',N'-Tetraacetate |
Synonyms: | N-[2-[2-[2-[Bis(2-methoxy-2-oxoethyl)amino]-5-formylphenoxy]ethoxy]-4-methylphenyl]-N-(2-methoxy-2-oxoethyl)-glycine Methyl Ester |
CAS: | 96315-11-6 |
Molecular Formula: | C28H34N2O11 |
Molecular Weight: | 0 |
InChI: | InChI=1/C28H34N2O11/c1-19-6-8-21(29(14-25(32)36-2)15-26(33)37-3)23(12-19)40-10-11-41-24-13-20(18-31)7-9-22(24)30(16-27(34)38-4)17-28(35)39-5/h6-9,12-13,18H,10-11,14-17H2,1-5H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 373°C |
Boiling Point: | 693.1°C at 760 mmHg |
Density: | 1.281g/cm3 |
Refractive index: | 1.575 |
Flash Point: | 373°C |
Usage: | A fluorescent chelating indicator used to study the role of cytosolic free calcium.
Fluorescence: max. Abs. 284nm; e x 10-3: 5.1 |
Safety Data |
|
|