| Identification | |
| Name: | Pyridine,4-fluoro-2-methoxy- |
| Synonyms: | 4-Fluoro-2-methoxypyridine;NSC 361062; |
| CAS: | 96530-81-3 |
| Molecular Formula: | C6H6FNO |
| Molecular Weight: | 127.12 |
| InChI: | InChI=1/C6H6FNO/c1-9-6-4-5(7)2-3-8-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.146 g/cm3 |
| Refractive index: | 1.471 |
| Specification: |
The 4-Fluoro-2-methoxypyridine, with the cas registry number 96530-81-3, is also called pyridine, 4-fluoro-2-methoxy-. It belongs to the product category of Pyridine. And the molecular formula of the chemical is C6H6FNO. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.43; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 22.12 Å2; (7)Index of Refraction: 1.471; (8)Molar Refractivity: 31.01 cm3; (9)Molar Volume: 110.8 cm3; (10)Polarizability: 12.29×10-24cm3; (11)Surface Tension: 32.7 dyne/cm; (12)Density: 1.146 g/cm3; (13)Flash Point: 33.6 °C; (14)Enthalpy of Vaporization: 35.42 kJ/mol; (15)Boiling Point: 131.9 °C at 760 mmHg; (16)Vapour Pressure: 11.1 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
