Identification |
Name: | Propanoic acid,2-(4-hydroxyphenoxy)-, methyl ester, (2R)- |
Synonyms: | Propanoicacid, 2-(4-hydroxyphenoxy)-, methyl ester, (R)-;(R)-2-(4-Hydroxyphenoxy)propionic acid methyl ester;Methyl(+)-2-(4-hydroxyphenoxy)propionate;Methyl (R)-2-(4-hydroxyphenoxy)propionate; |
CAS: | 96562-58-2 |
EINECS: | 411-950-4 |
Molecular Formula: | C10H12O4 |
Molecular Weight: | 196.2 |
InChI: | InChI=1/C10H12O4/c1-7(10(12)13-2)14-9-5-3-8(11)4-6-9/h3-7,11H,1-2H3/t7-/m1/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 121.6°C |
Boiling Point: | 313.4°Cat760mmHg |
Density: | 1.187g/cm3 |
Stability: | Stable under normal shipping and handling conditions. |
Refractive index: | 42.5 ° (C=1, CHCl3) |
Solubility: | Slightly soluble |
Appearance: | Liquid. |
Specification: |
Propanoic acid,2-(4-hydroxyphenoxy)-, methyl ester, (2R)- , its cas register number is 96562-58-2. It also can be called Methyl (R)-(+)-2-(4-hydroxyphenoxy)propanoate .It is a liquid.
|
Flash Point: | 121.6°C |
Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |