| Identification | |
| Name: | 4-[(2,4-diamino-5-methyl-phenyl)methyl]-6-methyl-benzene-1,3-diamine |
| Synonyms: | 4-[(2,4-diamino-5-methyl-phenyl)methyl]-6-methyl-benzene-1,3-diamine;bis-5,5'-(2,4,2',4'-tetraminotolyl)methane;2,2'-Methylenebis(4-methyl-1,5-benzenediamine);4,4'-Methylenebis(6-methyl-1,3-benzenediamine);6,6'-Methylenebis(4-methylbenzene-1,3-diamine);Bis(2,4-diamino-5-methylphenyl)methane |
| CAS: | 97-22-3 |
| Molecular Formula: | C15H20N4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H20N4/c1-8-3-10(14(18)6-12(8)16)5-11-4-9(2)13(17)7-15(11)19/h3-4,6-7H,5,16-19H2,1-2H3 |
| Molecular Structure: | ![(C15H20N4) 4-[(2,4-diamino-5-methyl-phenyl)methyl]-6-methyl-benzene-1,3-diamine;bis-5,5'-(2,4,2',4'-tetraminoto...](https://img.guidechem.com/structure/97-22-3.gif) |
| Properties | |
| Flash Point: | 307.5°C |
| Boiling Point: | 524°C at 760 mmHg |
| Density: | 1.217g/cm3 |
| Refractive index: | 1.708 |
| Specification: | Pale Yellow Solid usageEng:It is formed by interaction of methanol and the aromatic amine 2,4-diaminotoluene. A new mutagenic compound. |
| Flash Point: | 307.5°C |
| Usage: | It is formed by interaction of methanol and the aromatic amine 2,4-diaminotoluene. A new mutagenic compound. |
| Safety Data | |
 |
|
