| Identification | |
| Name: | Eugenol |
| Synonyms: | 1,3,4-eugenol; 1-Allyl-3-methoxy-4-hydroxybenzene; 1-allyl-4-hydroxy-3-methoxybenzene; 1-hydroxy-2-methoxy-4-allylbenzene; 1-hydroxy-2-methoxy-4-prop-2-enylbenzene; 1-hydroxy-2-methoxy-4-propenylbenzene; 1-hydroxy-4-allyl-2-methoxybenzene; 2-methoxy-1-hydroxy-4-allylbenzene; 2-methoxy-4-(2-propen-1-yl)phenol; 2-Methoxy-4-(2-propenyl)phenol; 2-Methoxy-4-allylphenol; 2-methoxy-4-prop-2-enylphenol; 4-allyl-1-hydroxy-2-methoxybenzene; 4-Allyl-2-methoxyphenol; 4-allylcatechol-2-methyl ether; 4-Allylguaiacol; p-eugenol; 4-hydroxy-3-methoxyallylbenzene; 5-allylguaiacol; Allylguaiacol; Caryophyllic acid; Eugenic acid; Eugenol Special; FA 100; fema no. 2467; |
| CAS: | 97-53-0 |
| EINECS: | 202-589-1 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3,5-7,11H,1,4H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >230 ºF |
| Density: | 1.066 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.54-1.542 |
| Water Solubility: | slightly soluble |
| Solubility: | Water Solubility :slightly soluble |
| Appearance: | colourless to faintly yellow liquid with a strong odour of cloves |
| HS Code: | 29095090 |
| Flash Point: | >230 ºF |
| Color: | Colorless or pale yellow liquid CRYSTALS FROM HEXANE |
| Usage: | In perfumery instead of oil of cloves, manufacture of vanillin, insect attractant. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
