| Identification |
| Name: | Ethyl Methacrylate |
| Synonyms: | 2-Methyl-2-Propenoic Acid Ethyl Ester; ethyl 2-methyl-2-propenoate; ethyl alpha-methylacrylate; Methacrylic Acid Ethyl Ester; Rhoplex ac-33; 2-methyl-2-propenoicacid,ethylester; 2-methyl-2-propenoicaciethylester; 2-Methylacrylic acid, ethyl ester; 2-methyl-prop-2-enoicacidethylester; 2-Propenoicacid,2-methyl-,ethylester; EMA; Ethyl 2-methacrylate |
| CAS: | 97-63-2 |
| EINECS: | 202-597-5 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2277 |
| Density: | 0.917 |
| Stability: | Polymerizes in the presence of light or heat. Incompatible with peroxides, oxidizing agents, bases, acids, reducing agents, halogens and amines. Flammable. |
| Refractive index: | 1.413-1.415 |
| Solubility: | 4 g/L (20 ºC) |
| Appearance: | colourless liquid with an unpleasant odour(well known as Plexiglass in the polymerized form) |
| Packinggroup: | II |
| HS Code: | 29161490 |
| Color: | Colorless, liquid |
| Usage: | Ethyl methacrylate is used to make polymers, which in turn are used for building, automotive, aerospace, and furniture industries. |
| Safety Data |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
| |
 |
