| Identification | |
| Name: | Tetramethyl thiuram monosulfide |
| Synonyms: | tetramethylthiodicarbonic diamide; accelerator tmtm; thiodicarbonic diamide , tetramethyl-; tetramethylthiuram monosulfide; tmtm; tetramethy thiuram monosulfide; 1,1'-thiobis(n,n-dimethylthio-formamid; acceleratortmtm; aceto tmtm; acetotmtm; ancazide is; anhydridetetramethyltrithiocarbamique; bis(dimethylthiocarbamyl) monosulfide; bis(dimethylthiocarbamyl)monosulfide; carbamic acid, dimethyldithio-, anhydrosulfide; carbamic anhydride, tetramethyltrithio-; carbamodithioic acid, dimethyl-, anhydrosulfide; cp2113; cyuram ms; dimethyl-carbamodithioicacianhydrosulfide; dimethyldithio-carbamicacianhydrosulfide; ekagom tm; ekagomtm; formamide, 1,1'-thiobis(n,n-dimethylthio-; monosulfure de tetramethylthiurame; monosulfuredetetramethylthiurame |
| CAS: | 97-74-5 |
| EINECS: | 202-605-7 |
| Molecular Formula: | C6H12N2S3 |
| Molecular Weight: | 208.35 |
| InChI: | InChI=1/C6H12N2S3/c1-7(2)5(9)11-6(10)8(3)4/h1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 150 C |
| Density: | 1.255g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.64 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | yellow to brownish powder |
| Packinggroup: | III |
| Flash Point: | 150 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Yellow powder |
| Usage: | Vulcanisation accelerator. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
