| Identification | |
| Name: | Isobutyl isobutyrate |
| Synonyms: | isobutyl-isobutyrate; |
| CAS: | 97-85-8 |
| EINECS: | 202-612-5 |
| Molecular Formula: | C8H16O2 |
| Molecular Weight: | 144.21 |
| InChI: | InChI=1/C8H16O2/c1-6(2)5-10-8(9)7(3)4/h6-7H,5H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2528 |
| Density: | 0.856 |
| Refractive index: | 1.398-1.400 |
| Solubility: | 0.5 G PER 100 ML WATER SOL IN ALC ETHER AND ACETONE SOL IN MOST ORGANIC SOLVENTS Water solubility of 1000 mg/l at 20 deg C. |
| Appearance: | colorless liquid |
| Specification: |
?Isobutyl isobutyrate , its CAS NO. is 97-85-8, the synonyms are 2-Methyl-1-propyl 2-methylpropanoate ; 2-Methylpropyl 2-methylpropanoate ; 2-Methylpropyl 2-methylpropionate ; 2-Methylpropyl isobutyrate ; Isobutyl 2-methylpropanoate ; Isobutylester kyseliny isomaselne ; Isobutyric acid, isobutyl ester ; Propanoic acid, 2-methyl-, 2-methylpropyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
