| Identification |
| Name: | Isobutyl methacrylate |
| Synonyms: | 2-methyl-2-propenoic acid, 2-methylpropyl ester; 2-methylpropyl 2-methylpropenoate; 2-methylpropyl methacrylate; 2-Propenoic acid, 2-methyl-, 2-methylpropyl ester; Isobutyl methacrylate, stabilized with 15-20 ppm MEHQ; |
| CAS: | 97-86-9 |
| EINECS: | 202-613-0 |
| Molecular Formula: | C8H14O2 |
| Molecular Weight: | 142.2 |
| InChI: | InChI=1/C8H14O2/c1-6(2)5-10-8(9)7(3)4/h6H,3,5H2,1-2,4H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2283 |
| Density: | 0.886 |
| Stability: | Light, heat and air sensitive. Polymerizes readily. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.419-1.421 |
| Water Solubility: | insoluble Stability Light, heat and air sensitive. Polymerizes readily. Combustible. Incompatible with strongoxidizing agents. Toxicology May be harmful or act as an irritant. To |
| Solubility: | insoluble |
| Appearance: | clear, colorless liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Color: | Liquid |
| Usage: | Monomer for acrylic resins. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
| |
 |
