| Identification | |
| Name: | 2-Ethylbutyraldehyde |
| Synonyms: | 2-Ethylbutanal |
| CAS: | 97-96-1 |
| EINECS: | 202-623-5 |
| Molecular Formula: | C6H12O |
| Molecular Weight: | 100.16 |
| InChI: | InChI=1/C6H12O/c1-3-6(4-2)5-7/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1178 3/PG 2 |
| Melting Point: | -89 |
| Density: | 0.81 |
| Stability: | Stability Stable, but air sensitive. Flammable. Readily forms explosive mixtures with air. Incompatible with strong bases, strong reducing agents, oxidizing agents. |
| Refractive index: | n20/D 1.402(lit.) |
| Solubility: | Insoluble in water, miscible in alcohol and ether |
| Appearance: | liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
F:Highlyflammable
Xi:Irritant
|
 |
|
