Identification |
Name: | Dibenz[a,h]acridine,8,9,10,11-tetrahydro- |
Synonyms: | LogP |
CAS: | 97135-12-1 |
Molecular Formula: | C21H17 N |
Molecular Weight: | 0 |
InChI: | InChI=1/C21H17N/c1-3-7-17-14(5-1)11-12-20-19(17)13-16-10-9-15-6-2-4-8-18(15)21(16)22-20/h1,3,5,7,9-13H,2,4,6,8H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 231.5°C |
Boiling Point: | 518.1°C at 760 mmHg |
Density: | 1.222g/cm3 |
Refractive index: | 1.752 |
Flash Point: | 231.5°C |
Usage: | This compound is an interesting intermediate in the synthesiis of the epoxy-diol derivtives of dibenz(a,h)acridine (Catalogue number D41690) which is the proximate or ultimate carcinogen |
Safety Data |
|
|