| Identification | |
| Name: | Formamide,N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)-1-buten-1-yl]-,hydrochloride (1:1) |
| Synonyms: | Formamide,N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)-1-butenyl]-,monohydrochloride (8CI,9CI); Dithiopropylthiamine hydrochloride; Prosultiaminehydrochloride; Thiamine propyl disulfide hydrochloride |
| CAS: | 973-99-9 |
| EINECS: | 213-547-7 |
| Molecular Formula: | C15H24 N4 O2 S2 . Cl H |
| Molecular Weight: | 393.01 |
| InChI: | InChI=1/C15H24N4O2S2.ClH/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16;/h8,10,20H,4-7,9H2,1-3H3,(H2,16,17,18);1H |
| Molecular Structure: | ![(C15H24N4O2S2.ClH) Formamide,N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)-1-buteny...](https://img1.guidechem.com/chem/e/dict/119/973-99-9.jpg) |
| Properties | |
| Flash Point: | 312.9°C |
| Boiling Point: | 593.7°Cat760mmHg |
| Density: | 1.261g/cm3 |
| Specification: |
Dithiopropylthiamine hydrochloride with cas registry number of 973-99-9 is also known as N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)but-1-en-1-yl]formamide monohydrochloride ; Thiamine propyl disulfide hydrochloride . It is a solid and this compound is stable under normal temperatures and pressures but it also should be stored in a cool, dry place when not in use. Dithiopropylthiamine hydrochloride with cas registry number of 973-99-9 is used as a pharmaceutical Intermediate. |
| Flash Point: | 312.9°C |
| Safety Data | |
 |
|
