| Identification | |
| Name: | QUINELORANE 2HCL |
| Synonyms: | QUINELORANE 2HCL;QUINELORANE DIHYDROCHLORIDE (LY-163,502) D2 DOPAMINE RECEPTOR;LY-163,502, (5aR-trans)-5,5a,6,7,8,9,9a,10-Octahydro-6-propylpyrido[2,3-g]quinazolin-2-amine dihydrochloride;Quinelorane hydrochloride |
| CAS: | 97548-97-5 |
| Molecular Formula: | C14H22N4.2ClH |
| Molecular Weight: | 319.278 |
| InChI: | InChI=1/C14H22N4.2ClH/c1-2-5-18-6-3-4-10-7-12-11(8-13(10)18)9-16-14(15)17-12;;/h9-10,13H,2-8H2,1H3,(H2,15,16,17);2*1H/t10-,13-;;/m1../s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 219°C |
| Boiling Point: | 438.5°C at 760 mmHg |
| Density: | g/cm3 |
| Biological Activity: | Dopamine D 2 and D 3 receptor agonist; K i values are 5.7 and 3.4 nM respectively. |
| Flash Point: | 219°C |
| Safety Data | |
 |
|
