Identification |
Name: | Benzenesulfonic acid, mono-C10-14-alkyl derivs., compds. with neutralized aniline-nitrobenzene reaction products |
Synonyms: | Benzenesulfonic acid, mono-C10-14-alkyl derivs., compds. with neutralized aniline nitrobenzene reaction products;Benzenesulfonic acid, mono-C10-14-alkyl derivs, compds. with neutralized aniline-nitrobenzene reaction products;aniline; benzenesulfonic acid; nitrobenzene |
CAS: | 97925-92-3 |
EINECS: | 308-204-4 |
Molecular Formula: | C18H18N2O5S |
Molecular Weight: | 374.4109 |
InChI: | InChI=1/C6H5NO2.C6H7N.C6H6O3S/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6;7-10(8,9)6-4-2-1-3-5-6/h1-5H;1-5H,7H2;1-5H,(H,7,8,9) |
Molecular Structure: |
 |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Flash Point: | °C |
Safety Data |
|
 |