| Identification | |
| Name: | Benzene,(1-bromoethenyl)- |
| Synonyms: | Styrene, a-bromo- (7CI,8CI);(1-Bromoethenyl)benzene;(1-Bromovinyl)benzene;1-Bromo-1-phenylethene;1-Bromo-1-phenylethylene;1-Bromostyrene;1-Phenylvinyl bromide;a-Bromostyrene; |
| CAS: | 98-81-7 |
| EINECS: | 202-702-4 |
| Molecular Formula: | C8H7Br |
| Molecular Weight: | 183.05 |
| InChI: | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | −44 °C(lit.) |
| Flash Point: | 98.3°C |
| Boiling Point: | 67-70 °C4 mm Hg(lit.) |
| Density: | 1.387g/cm3 |
| Refractive index: | n20/D 1.588(lit.) |
| Appearance: | clear yellow liquid |
| Specification: | clear yellow liquid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 98.3°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
