| Identification |
| Name: | N,N-Dimethylcyclohexylamine |
| Synonyms: | N-Cyclohexyldimethylamine; n,n-dimethyl cyclohexylamine; N,N-Dimethylcyclohexylamine, (Cyclohexyldimethylamine); N,N-Dimethylcyclohexylamine,(Cyclohexyldimethylamine); N,N-Dimethylcyclohexylamine/Cyclohexyldimethylamine; Cyclohexyldimethylamine; DMCHA |
| CAS: | 98-94-2 |
| EINECS: | 202-715-5 |
| Molecular Formula: | C8H17N |
| Molecular Weight: | 127.23 |
| InChI: | InChI=1/C8H17N/c1-9(2)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2264/2266 |
| Density: | 0.849 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4525-1.4545 |
| Appearance: | clear liquid |
| Packinggroup: | II |
| HS Code: | 29213010 |
| Storage Temperature: | Flammables area |
| Color: | WATER-WHITE LIQ |
| Usage: | Catalyst for polyurethane foams, intermediate for rubber accelerators, treatment of textiles. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
