| Identification | |
| Name: | 2-(1,3-thiazol-4-yl)-1H-benzoimidazole |
| Synonyms: | Ai3-50598 |
| CAS: | 98002-42-7 |
| Molecular Formula: | C10H7N3S |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C10H7N3S/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-6H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 304-305 deg C |
| Solubility: | Max solubility in water at pH 2.2: 3.84%; slightly sol in alcohols, esters, chlorinated hydrocarbons In n-heptane Slightly soluble in ethanol In water, 50 mg/L at 25 deg C |
| Color: | Colorless crystals White crystals Off-white powder White to practically white powder White to tan crystals |
| Safety Data | |
 |
|
