| Identification | |
| Name: | 2,4,5-Trifluorobenzonitrile |
| CAS: | 98349-22-5 |
| Molecular Formula: | C7H2F3N |
| Molecular Weight: | 157.09 |
| InChI: | InChI=1/C7H2F3N/c8-5-2-7(10)6(9)1-4(5)3-11/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Melting Point: | 168-170 ºC |
| Density: | 1.373 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4736 |
| Solubility: | Insoluble |
| Appearance: | Colorless Liquid |
| Specification: |
2,4,5-Trifluorobenzonitrile ,its cas register number is 98349-22-5. It also can be called 2,4,5-Trifluorbenzolcarbonitril ; and Benzonitrile, 2,4,5-trifluoro- . |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
