| Identification | |
| Name: | 2-Pyrimidinamine,5-(1-methylethyl)- |
| Synonyms: | Pyrimidine,2-amino-5-isopropyl- (6CI); |
| CAS: | 98432-17-8 |
| Molecular Formula: | C7H11N3 |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C7H11N3/c1-5(2)6-3-9-7(8)10-4-6/h3-5H,1-2H3,(H2,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.966°C |
| Boiling Point: | 278.856°C at 760 mmHg |
| Density: | 1.07g/cm3 |
| Refractive index: | 1.55 |
| Specification: |
The chemical synonyms of 5-Propan-2-ylpyrimidin-2-amine (CAS NO.98432-17-8) are Pyrimidine,2-amino-5-isopropyl- ; 5-Isopropyl-2-pyrimidinamine ; 5-(1-Methylethyl)-2-pyrimidinamine ; Pyrimidine,2-amino-5-isopropyl- (6CI) ; 5-Isopropyl-pyrimidin-2-ylamine ; 5-Isopropylpyrimidin-2-amine ; 2-Pyrimidinamine,5-isopropyl- .It can be used for pharmaceuticalintermediates, also can reduce the side effects of some drugs, while increasing the drug health function. This product should be stored in a cool, ventilated, dry warehouse. |
| Flash Point: | 146.966°C |
| Safety Data | |
 |
|
