| Identification | |
| Name: | 3,5-Dihydroxybenzoic acid |
| Synonyms: | alpha-Resorcylic acid; 3,5-dihydroxy-benzoicaci; 5-carboxyresorcinol; Benzoicacid,3,5-dihydroxy-; DOHBA; A-RESORCYLIC ACID; ALPHA-RESERCYLIC ACID; 3,5-Dihydroxy? benzoic? acid; |
| CAS: | 99-10-5 |
| EINECS: | 202-730-7 |
| Molecular Formula: | C7H6O4 |
| Molecular Weight: | 154.12 |
| InChI: | InChI=1/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.559 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | white to off-white crystalline powder |
| Specification: |
?Benzoic acid,3,5-dihydroxy- , its cas register number 99-10-5. It also can be called?3,5-Dihydroxybenzoic acid ;?Acide 3,5-dihydroxybenzo?que ; and 5-Carboxyresorcinol .?Benzoic acid,3,5-dihydroxy- (CAS NO.99-10-5)?should avoid the condition like incompatible materials, excess heat, exposure to moist air or water. It is not compatible with strong oxidizing agents, strong bases. And also prevent it to broken down into hazardous decomposition products: carbon monoxide, carbon dioxide. However, its hazardous polymerization has not been reported. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29182990 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
