| Identification | |
| Name: | Benzeneacetonitrile, a-(b-D-glucopyranosyloxy)-, (aR)- |
| Synonyms: | Benzeneacetonitrile,a-(b-D-glucopyranosyloxy)-, (R)-; Prunasin (6CI,7CI,8CI);(2R)-Prunasin; (R)-Prunasin; D-Prunasin |
| CAS: | 99-18-3 |
| EINECS: | 202-738-0 |
| Molecular Formula: | C14H17 N O6 |
| Molecular Weight: | 295.29 |
| InChI: | InChI=1/C14H17NO6/c15-6-9(8-4-2-1-3-5-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h1-5,9-14,16-19H,7H2/t9-,10+,11+,12-,13+,14+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 138-148°C |
| Flash Point: | 272.5°C |
| Boiling Point: | 527°Cat760mmHg |
| Density: | 1.45g/cm3 |
| Specification: | White Solid usageEng:Used in the synthesis of cyanogen glycoside. A component of antiperspirants, deodorants, body soaps, shampoos, hair rinses, and hair Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 272.5°C |
| Usage: | Used in the synthesis of cyanogen glycoside. A component of antiperspirants, deodorants, body soaps, shampoos, hair rinses, and hair |
| Safety Data | |
 |
|
