| Identification | |
| Name: | a-D-Glucopyranoside, a-D-glucopyranosyl |
| Synonyms: | Trehalose(8CI);D-Trehalose;Ergot sugar;Mycose;NSC 2093;Naturaltrehalose;O-D-Glucopyranosyl-(1 1)-D-glucopyranoside;Treha;Trehalose P;Trehaose;a,a-Trehalose;a,a'-D-Trehalose;a-D-Trehalose;a-Trehalose; |
| CAS: | 99-20-7 |
| EINECS: | 202-739-6 |
| Molecular Formula: | C12H22O11 |
| Molecular Weight: | 342.30 |
| InChI: | InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.76 g/cm3 |
| Solubility: | Soluble in water and hot ethanol, insoluble in ethyl ether |
| Appearance: | white to off-white crystalline powder |
| Specification: |
Trehalose , its CAS NO. is 99-20-7, the synonyms are EINECS 202-739-6 ; Ergot sugar ; Mycose ; NSC 2093 ; Natural trehalose ; TREHALOSE, DIHYDRATE ; UNII-B8WCK70T7I ; alpha-D-Trehalose ; alpha-D-Glucopyranoside, alpha-D-glucopyranosyl . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
