| Identification | |
| Name: | 1,3,2-Benzodioxabismole-5-carboxylicacid, 2,7-dihydroxy- |
| Synonyms: | Bismuthsubgallate (7CI);Basic bismuth gallate;Bismuth gallate, basic;Dermatol;Devrom; |
| CAS: | 99-26-3 |
| EINECS: | 202-742-2 |
| Molecular Formula: | C7H5BiO6 |
| Molecular Weight: | 395.09932 |
| InChI: | InChI=1S/C7H6O5.Bi.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;;/h1-2,8-10H,(H,11,12);;1H2/q;+2;/p-2 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Stability: | Stable, but may be light sensitive. |
| Water Solubility: | Insoluble in water. |
| Solubility: | Insoluble in water. |
| Appearance: | White to yellow crystals. |
| Specification: |
Bismuth Subgallate ,its CAS NO. is 99-26-3, the synonyms are Basic bismuth gallate ; Bismutum subgallicum ; Caswell No. 098B ; Dermatol puder ; EINECS 202-742-2 ; EPA Pesticide Chemical Code 098601 ; UNII-YIW503MI7V ; Wismutgallat, basisches ; Wismutgallathydroxid ; Gallic acid bismuth basic salt ; 1,3,2-Benzodioxabismole-5-carboxylic acid, 2,7-dihydroxy- ; Bismuth 3,4,5-trihydroxybenzoate, basic . |
| Safety Data | |
 |
|
