| Identification | |
| Name: | 2-Cyclohexen-1-ol,2-methyl-5-(1-methylethenyl)- |
| Synonyms: | p-Mentha-6,8-dien-2-ol(8CI); 2-Methyl-5-(1-methylethenyl)-2-cyclohexen-1-ol;2-Methyl-5-isopropenyl-2-cyclohexen-1-ol;5-Isopropenyl-2-methyl-2-cyclohexen-1-ol; Carveol; NSC 68313;p-Mentha-1,8-dien-6-ol |
| CAS: | 99-48-9 |
| EINECS: | 202-757-4 |
| Molecular Formula: | C10H16 O |
| Molecular Weight: | 152.23 |
| InChI: | InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.49 |
| Refractive index: | n20/D 1.496 |
| Specification: |
Flammable and/or toxic gases are generated by the combination of alcohols with alkali metals, nitrides, and strong reducing agents. They react with oxoacids and carboxylic acids to form esters plus water. Oxidizing agents convert them to aldehydes or ketones. Alcohols exhibit both weak acid and weak base behavior. They may initiate the polymerization of isocyanates and epoxides. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
