| Identification | |
| Name: | 3,4-Dichloronitrobenzene |
| Synonyms: | 1,2-Dichloro-4-nitrobenzene; 3,4-Dichlornitrobenzene; DCNB 1,2-Dichloro-4-benzenesulfonamido-5-nitrobenzene; 4-Chloro-o-dichlorobenzene; 3,4-Dichloronitrobenzcne; 3,4-Dichloro-4-nitrobenzenc; 3,4-DCNB |
| CAS: | 99-54-7 |
| EINECS: | 202-764-2 |
| Molecular Formula: | C6H3Cl2NO2 |
| Molecular Weight: | 192 |
| InChI: | InChI=1/C6H3Cl2NO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 255 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.595 |
| Solubility: | 151 mg/L (20 oC) |
| Appearance: | colourless to yellow crystals or beige powder |
| Packinggroup: | III |
| HS Code: | 29049085 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Color: | Needles from alcohol SOLID |
| Usage: | Chemical intermediate for herbicides (eg, propanil) and insecticides & dye intermediates. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
