| Identification | |
| Name: | 1,3-Dinitrobenzene |
| Synonyms: | Dinitrobenzene; 2,4-Dinitrobenzene; m-Dinitrobenzene |
| CAS: | 99-65-0 |
| EINECS: | 202-776-8 |
| Molecular Formula: | C6H4N2O4 |
| Molecular Weight: | 168.11 |
| InChI: | InChI=1/C6H4N2O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3443 |
| Density: | 1.575 |
| Stability: | Stable. Incompatible with reducing agents, oxidizing agents, strong bases. May explode if heated. |
| Refractive index: | 1.612 |
| Solubility: | 500 mg/L (20 oC) |
| Appearance: | Yellow solid with a slight odor. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | II |
| Color: | Yellowish crystals Colorless to yellow, rhombic needles or plates Pale white or yellow, crystalline solid. |
| Usage: | Chemical intermediate for: m-phenylenediamine, used for aramid fibers, spandex fibers, dyes, explosives. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
N:Dangerousfortheenvironment
|
 |
|
