| Identification | |
| Name: | 4-sec-butylphenol |
| Synonyms: | p-(1-Methylpropyl)phenol; Butylphenol; N-Hydroxyethyl Benzamide; Para-sec-butylphenol |
| CAS: | 99-71-8 |
| EINECS: | 202-781-5 |
| Molecular Formula: | C10H14O |
| Molecular Weight: | 150.22 |
| InChI: | InChI=1/C10H14O/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8,11H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2430 |
| Flash Point: | 240? |
| Density: | 0.972g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.5195 (20 C) |
| Solubility: | Soaringly soluble |
| Appearance: | White crystalline solid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 240? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
