| Identification | |
| Name: | Ethyl p-nitrobenzoate |
| Synonyms: | Benzoicacid, p-nitro-, ethyl ester (6CI,8CI);4-(Ethoxycarbonyl)nitrobenzene;4-Ethoxycarbonyl-1-nitrobenzene;4-Nitrobenzoic acid ethyl ester;Ethyl4-nitrobenzoate; |
| CAS: | 99-77-4 |
| EINECS: | 202-786-2 |
| Molecular Formula: | C9H9NO4 |
| Molecular Weight: | 195.17 |
| InChI: | InChI=1/C9H9NO4/c1-2-14-9(11)7-3-5-8(6-4-7)10(12)13/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.253 g/cm3 |
| Refractive index: | 1.544 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | yellow crystalline powder |
| Specification: |
Ethyl p-nitrobenzoate , with CAS number of 99-77-4, can be called Ethyl4-nitrobenzoate ; 4-Nitrobenzoic acid ethyl ester ; 4-Ethoxycarbonyl-1-nitrobenzene ; 4-(Ethoxycarbonyl)nitrobenzene . Ethyl p-nitrobenzoate (CAS NO.99-77-4) is used as intermediates in organic synthesis. In the pharmaceutical industry for the production of local anesthetic benzocaine, tetracaine hydrochloride and retirement cough and other antitussives. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
