| Identification |
| CAS: | 99-81-0 |
| EINECS: | 202-789-9 |
| Molecular Formula: | C8H6BrNO3 |
| Molecular Weight: | 244.04 |
| InChI: | InChI=1/C8H6BrNO3/c9-5-8(11)6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3261 |
| Flash Point: | 150.5°C |
| Boiling Point: | 325.2°C at 760 mmHg |
| Density: | 1.671g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.609 |
| Appearance: | Gold powder. |
| Packinggroup: | III |
| Flash Point: | 150.5°C |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Keep container closed when not in use. Corrosives area. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
