| Identification | |
| Name: | 4'-Chloroacetophenone |
| Synonyms: | 1-(4-Chlorophenyl)ethanone; 4-Chloroacetophenone; 4-Chloro Acetophenone ; 1-(4-chlorophenyl)-ethanon ; 1-(4-chlorophenyl)ethanone[qr] ; 4'-chloro-acetophenon ; 4-acetylchlorobenzene ; 4-chloroacetophenone[qr] ; 4-chlorophenylmethylketone ; Acetophenone, 4'-chloro- ; acetophenone,4-chloro-[qr] |
| CAS: | 99-91-2 |
| EINECS: | 202-800-7 |
| Molecular Formula: | C8H7ClO |
| Molecular Weight: | 154.59 |
| InChI: | InChI=1/C8H7ClO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3416 |
| Density: | 1.192 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5539-1.5559 |
| Solubility: | 111 mg/L (25 oC) in water |
| Appearance: | colorless to light yellow liquid |
| Packinggroup: | II |
| HS Code: | 29147090 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Color: | LIQUID |
| Usage: | Chemical intermediate for pharmaceuticals. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
