| Identification | |
| Name: | Clethodim |
| Synonyms: | Prism;2-Cyclohexen-1-one, 2-(1-(((3-chloro-2-propenyl)oxy)imino)propyl)-5-(2-(ethylthio)propyl)-3-hydroxy-;2-(1-(((3-Chloro-2-propenyl)oxy)imino)propyl)-5-(2-(ethylthio)propyl)-3-hydroxy-2-cyclohexen-1-one;Prism (pesticide);Select;104233-53-6;Clethodim [ISO];85% Clethodim;Centurion 240;EPA Pesticide Chemical Code 121011;RE 45601;(E)-2-[1-[[(3-Chloro-2-propenyl)oxy]imino]propyl]-5-{2-(ethylthio)propyl}-3-hydroxy-2-cyclohexene-1-one;Clethodim Tech;Clethodim 90%Tech; |
| CAS: | 99129-21-2 |
| Molecular Formula: | C17H26ClNO3S |
| Molecular Weight: | 359.91 |
| InChI: | InChI=1/C17H26ClNO3S/c1-4-14(19-22-8-6-7-18)17-15(20)10-13(11-16(17)21)9-12(3)23-5-2/h6-7,12-13,20H,4-5,8-11H2,1-3H3/b7-6?,19-14+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.151g/cm3 |
| Refractive index: | 1.531 |
| Appearance: | Light Yellow Liquid |
| Specification: |
? Clethodim , with CAS number of 99129-21-2, can be called 2-(1-(((3-Chloro-2-propenyl)oxy)imino)propyl)-5-(2- |
| Safety Data | |
 |
|
