| Identification |
| Name: | 1H-3-Benzazepin-7-ol,8-bromo-2,3,4,5-tetrahydro-3-methyl-5-phenyl- |
| CAS: | 99295-33-7 |
| Molecular Formula: | C17H18 Br N O |
| Molecular Weight: | 413.15 |
| InChI: | InChI=1/C17H18BrNO.BrH/c1-19-8-7-13-9-16(18)17(20)10-14(13)15(11-19)12-5-3-2-4-6-12;/h2-6,9-10,15,20H,7-8,11H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 224.4°C |
| Boiling Point: | 447.5°Cat760mmHg |
| Density: | g/cm3 |
| Biological Activity: | Potent and selective D 1 -like dopamine receptor antagonist (K i ~ 0.56 nM for D 1 ; K B = 2 μ M for D 2 ). Also antagonist at the vascular 5-HT 2 receptor (K i = 11 nM). Centrally active following systemic administration in vivo . |
| Flash Point: | 224.4°C |
| Color: | light tan |
| Safety Data |
| |
 |
