| Identification | |
| Name: | 1-Chloroethyl cyclohexyl carbonate |
| Synonyms: | 1-Chloroethyl Cyclohexyl Carbonate (JCC-2);Intermediate of Candesartan Cilexetil;1-Chloroethyl Cyclohexyl Carbonate (Intermediate of Candesartan Cilexetil);1-Chloro Ethyl Cyclohexyl Carbonate;Cyclohexyl-(1-chloroethyl)-carbonate; |
| CAS: | 99464-83-2 |
| Molecular Formula: | C9H15ClO3 |
| Molecular Weight: | 206.67 |
| InChI: | InChI=1/C9H15ClO3/c1-7(10)12-9(11)13-8-5-3-2-4-6-8/h7-8H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.13 g/cm3 |
| Refractive index: | 1.464 |
| Appearance: | Colorless and transparent liquid |
| Specification: |
??1-Chloroethyl cyclohexyl carbonate ,? its cas register number is 99464-83-2. It also can be called?Carbonic acid, 1-chloroethyl cyclohexyl ester . |
| Safety Data | |
 |
|
