| Identification | |
| Name: | Propanoic acid,2-methyl-, sodium salt (1:1) |
| Synonyms: | Isobutyricacid, sodium salt (8CI); Propanoic acid, 2-methyl-, sodium salt (9CI); Sodium2-methylpropanoate; Sodium 2-methylpropionate; Sodium isobutanoate; Sodiumisobutyrate |
| CAS: | 996-30-5 |
| EINECS: | 213-630-8 |
| Molecular Formula: | C4H8 O2 . Na |
| Molecular Weight: | 88.1051 |
| InChI: | InChI=1/C4H8O2.Na/c1-3(2)4(5)6;/h3H,1-2H3,(H,5,6);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -47 deg C |
| Density: | 0.983 g/cm3 |
| Solubility: | Slightly soluble in carbon tetrachloride Sol in 6 parts of water; miscible with alcohol, chloroform, and ether. In water, 1.67X10+5 mg/L at 20 deg C |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
