| Identification | |
| Name: | 1,1,2,2-Ethenetetramine,N1,N1,N1',N1',N2,N2,N2',N2'-octamethyl- |
| Synonyms: | Ethenetetramine,octamethyl- (7CI,8CI,9CI); 1,1,2,2-Tetrakis(dimethylamino)ethene; TMAE;Tetrakis(dimethylamine)ethylene; Tetrakis(dimethylamino)ethene;Tetrakis(dimethylamino)ethylene |
| CAS: | 996-70-3 |
| EINECS: | 213-638-1 |
| Molecular Formula: | C10H24 N4 |
| Molecular Weight: | 200.32 |
| InChI: | InChI=1/C10H24N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 |
| Flash Point: | 53 ºC |
| Density: | 0.861 |
| Stability: | Stable. Incompatible with acid chlorides, acids, strong oxidizing agents, acid anhydrides, carbon dioxide, oxygen, chlorinated solvents. Reacts with oxygen in air to give a greenish-yellow emission. Flammable. |
| Refractive index: | 1.48 |
| Appearance: | clear yellow liquid |
| Specification: |
Tetrakis(dimethylamino)ethylene (CAS No.996-70-3), its synonym is Octamethyl-ethylenetetramine . |
| Packinggroup: | III |
| Flash Point: | 53 ºC |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
