Identification |
Name: | 1,2-Propanediol, polymer with 1,1'-methylenebis[isocyanatobenzene] and methyloxirane |
Synonyms: | 1,2-Propanediol, polymer with 1,1'-methylenebis[isocyanatobenzene] and methyloxirane |
CAS: | 99784-49-3 |
Molecular Formula: | C21H24N2O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C15H10N2O2.C3H8O2.C3H6O/c18-10-16-14-5-1-3-12(8-14)7-13-4-2-6-15(9-13)17-11-19;1-3(5)2-4;1-3-2-4-3/h1-6,8-9H,7H2;3-5H,2H2,1H3;3H,2H2,1H3 |
Molecular Structure: |
![(C21H24N2O5) 1,2-Propanediol, polymer with 1,1'-methylenebis[isocyanatobenzene] and methyloxirane](https://img.guidechem.com/crawlimg/99784-49-3.png) |
Properties |
Flash Point: | 159.3°C |
Boiling Point: | 385.8°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 159.3°C |
Safety Data |
|
 |